About cyclonona-1,3-diene-1-carboximidamide
cyclonona-1,3-diene-1-carboximidamide (PubChem CID 123709241) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is cyclonona-1,3-diene-1-carboximidamide.
Molecular Properties
| Compound Name | cyclonona-1,3-diene-1-carboximidamide |
| PubChem CID | 123709241 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | cyclonona-1,3-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CC=CCCCCC1 |
| InChI | InChI=1S/C10H16N2/c11-10(12)9-7-5-3-1-2-4-6-8-9/h3,5,7H,1-2,4,6,8H2,(H3,11,12) |
| InChIKey | YCMHDISOSMUBBW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclonona-1,3-diene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclonona-1,3-diene-1-carboximidamide?
The IUPAC name of cyclonona-1,3-diene-1-carboximidamide (CID 123709241) is cyclonona-1,3-diene-1-carboximidamide.
What is the SMILES notation for cyclonona-1,3-diene-1-carboximidamide?
The canonical SMILES for cyclonona-1,3-diene-1-carboximidamide is [H]/N=C(\N)C1=CC=CCCCCC1.
What is the InChIKey of cyclonona-1,3-diene-1-carboximidamide?
The InChIKey is YCMHDISOSMUBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c11-10(12)9-7-5-3-1-2-4-6-8-9/h3,5,7H,1-2,4,6,8H2,(H3,11,12).
What are the key properties of cyclonona-1,3-diene-1-carboximidamide?
cyclonona-1,3-diene-1-carboximidamide has a molecular weight of 164.25 g/mol, XLogP of 2.37, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclonona-1,3-diene-1-carboximidamide is sourced from PubChem (CID 123709241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).