C24H37N3 — CID 123709314
3,6-ditert-butyl-9,10-dimethyl-4,4a,7a,8,9,10,11,11a-octahydrobenzimidazolo[2,1-f][1,6]naphthyridine (PubChem CID 123709314) has the molecular formula C24H37N3 and a molecular weight of 367.58 g/mol. Its IUPAC name is 3,6-ditert-butyl-9,10-dimethyl-4,4a,7a,8,9,10,11,11a-octahydrobenzimidazolo[2,1-f][1,6]naphthyridine.
| Compound Name | 3,6-ditert-butyl-9,10-dimethyl-4,4a,7a,8,9,10,11,11a-octahydrobenzimidazolo[2,1-f][1,6]naphthyridine |
|---|---|
| PubChem CID | 123709314 |
| Molecular Formula | C24H37N3 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | 3,6-ditert-butyl-9,10-dimethyl-4,4a,7a,8,9,10,11,11a-octahydrobenzimidazolo[2,1-f][1,6]naphthyridine |
| SMILES | CC1CC2N=C3C4=CC=C(C(C)(C)C)NC4C=C(C(C)(C)C)N3C2CC1C |
| InChI | InChI=1S/C24H37N3/c1-14-11-18-19(12-15(14)2)27-21(24(6,7)8)13-17-16(22(27)26-18)9-10-20(25-17)23(3,4)5/h9-10,13-15,17-19,25H,11-12H2,1-8H3 |
| InChIKey | FZZYRGRHTFWSJF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |