About N-(1-amino-1,3-diiminopropan-2-yl)acetamide
N-(1-amino-1,3-diiminopropan-2-yl)acetamide (PubChem CID 123709367) has the molecular formula C5H10N4O
and a molecular weight of 142.16 g/mol. Its IUPAC name is N-(1-amino-1,3-diiminopropan-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-amino-1,3-diiminopropan-2-yl)acetamide |
| PubChem CID | 123709367 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | N-(1-amino-1,3-diiminopropan-2-yl)acetamide |
| SMILES | [H]/N=C(\N)C(/C=N/[H])NC(C)=O |
| InChI | InChI=1S/C5H10N4O/c1-3(10)9-4(2-6)5(7)8/h2,4,6H,1H3,(H3,7,8)(H,9,10)/b6-2+ |
| InChIKey | LMCQPDTUMKTUCY-QHHAFSJGSA-N |
| XLogP | -0.92 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1-amino-1,3-diiminopropan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-1,3-diiminopropan-2-yl)acetamide?
The IUPAC name of N-(1-amino-1,3-diiminopropan-2-yl)acetamide (CID 123709367) is N-(1-amino-1,3-diiminopropan-2-yl)acetamide.
What is the SMILES notation for N-(1-amino-1,3-diiminopropan-2-yl)acetamide?
The canonical SMILES for N-(1-amino-1,3-diiminopropan-2-yl)acetamide is [H]/N=C(\N)C(/C=N/[H])NC(C)=O.
What is the InChIKey of N-(1-amino-1,3-diiminopropan-2-yl)acetamide?
The InChIKey is LMCQPDTUMKTUCY-QHHAFSJGSA-N. The full InChI is InChI=1S/C5H10N4O/c1-3(10)9-4(2-6)5(7)8/h2,4,6H,1H3,(H3,7,8)(H,9,10)/b6-2+.
What are the key properties of N-(1-amino-1,3-diiminopropan-2-yl)acetamide?
N-(1-amino-1,3-diiminopropan-2-yl)acetamide has a molecular weight of 142.16 g/mol, XLogP of -0.92, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-1,3-diiminopropan-2-yl)acetamide is sourced from PubChem (CID 123709367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).