C18H28N2O — CID 123709616
(3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-propylundeca-3,6,8-trienamide (PubChem CID 123709616) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-propylundeca-3,6,8-trienamide.
| Compound Name | (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-propylundeca-3,6,8-trienamide |
|---|---|
| PubChem CID | 123709616 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-propylundeca-3,6,8-trienamide |
| SMILES | [H]/N=C/C(/C=C(\C)C(=C)/C=C(C)\C=C/CC)C(=O)NCCC |
| InChI | InChI=1S/C18H28N2O/c1-6-8-9-14(3)11-15(4)16(5)12-17(13-19)18(21)20-10-7-2/h8-9,11-13,17,19H,4,6-7,10H2,1-3,5H3,(H,20,21)/b9-8-,14-11-,16-12+,19-13+ |
| InChIKey | NAUCADFFWIAOOM-UCECPRMXSA-N |
| XLogP | 4.19 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|