C11H12F2O — CID 123709706
1,3-difluoro-2-methyl-4-prop-2-ynoxyhepta-1,3,5-triene (PubChem CID 123709706) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 1,3-difluoro-2-methyl-4-prop-2-ynoxyhepta-1,3,5-triene.
| Compound Name | 1,3-difluoro-2-methyl-4-prop-2-ynoxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 123709706 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1,3-difluoro-2-methyl-4-prop-2-ynoxyhepta-1,3,5-triene |
| SMILES | C#CCOC(C=CC)=C(F)C(C)=CF |
| InChI | InChI=1S/C11H12F2O/c1-4-6-10(14-7-5-2)11(13)9(3)8-12/h2,4,6,8H,7H2,1,3H3 |
| InChIKey | MOUBZDLLYROFNE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|