About N-(dimethylamino)-N'-methylmethanimidamide
N-(dimethylamino)-N'-methylmethanimidamide (PubChem CID 123710091) has the molecular formula C4H11N3
and a molecular weight of 101.15 g/mol. Its IUPAC name is N-(dimethylamino)-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-(dimethylamino)-N'-methylmethanimidamide |
| PubChem CID | 123710091 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | N-(dimethylamino)-N'-methylmethanimidamide |
| SMILES | C/N=C/NN(C)C |
| InChI | InChI=1S/C4H11N3/c1-5-4-6-7(2)3/h4H,1-3H3,(H,5,6) |
| InChIKey | RXNQZNBKYQTTOU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(dimethylamino)-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dimethylamino)-N'-methylmethanimidamide?
The IUPAC name of N-(dimethylamino)-N'-methylmethanimidamide (CID 123710091) is N-(dimethylamino)-N'-methylmethanimidamide.
What is the SMILES notation for N-(dimethylamino)-N'-methylmethanimidamide?
The canonical SMILES for N-(dimethylamino)-N'-methylmethanimidamide is C/N=C/NN(C)C.
What is the InChIKey of N-(dimethylamino)-N'-methylmethanimidamide?
The InChIKey is RXNQZNBKYQTTOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3/c1-5-4-6-7(2)3/h4H,1-3H3,(H,5,6).
What are the key properties of N-(dimethylamino)-N'-methylmethanimidamide?
N-(dimethylamino)-N'-methylmethanimidamide has a molecular weight of 101.15 g/mol, XLogP of -0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dimethylamino)-N'-methylmethanimidamide is sourced from PubChem (CID 123710091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).