C20H27N3O3 — CID 123710240
N-(3,7-dimethyloct-6-enylideneamino)-4-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 123710240) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(3,7-dimethyloct-6-enylideneamino)-4-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-(3,7-dimethyloct-6-enylideneamino)-4-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 123710240 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-(3,7-dimethyloct-6-enylideneamino)-4-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | CC(C)=CCCC(C)CC=NNC(=O)c1ccc(C=CC(=O)NO)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-15(2)5-4-6-16(3)13-14-21-22-20(25)18-10-7-17(8-11-18)9-12-19(24)23-26/h5,7-12,14,16,26H,4,6,13H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | PJWGUPRSNAQIOS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|