C24H42N+ — CID 123710731
(4,6-diethyl-7-methyldec-1-en-3-yl)-[(4-methylcyclohexa-2,4-dien-1-yl)methyl]-methylideneazanium (PubChem CID 123710731) has the molecular formula C24H42N+ and a molecular weight of 344.61 g/mol. Its IUPAC name is (4,6-diethyl-7-methyldec-1-en-3-yl)-[(4-methylcyclohexa-2,4-dien-1-yl)methyl]-methylideneazanium.
| Compound Name | (4,6-diethyl-7-methyldec-1-en-3-yl)-[(4-methylcyclohexa-2,4-dien-1-yl)methyl]-methylideneazanium |
|---|---|
| PubChem CID | 123710731 |
| Molecular Formula | C24H42N+ |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.33 |
| IUPAC Name | (4,6-diethyl-7-methyldec-1-en-3-yl)-[(4-methylcyclohexa-2,4-dien-1-yl)methyl]-methylideneazanium |
| SMILES | C=CC(C(CC)CC(CC)C(C)CCC)[N+](=C)CC1C=CC(C)=CC1 |
| InChI | InChI=1S/C24H42N/c1-8-12-20(6)22(9-2)17-23(10-3)24(11-4)25(7)18-21-15-13-19(5)14-16-21/h11,13-15,20-24H,4,7-10,12,16-18H2,1-3,5-6H3/q+1 |
| InChIKey | ZMTGMYPVBRTRBQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|