About N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline
N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline (PubChem CID 123711007) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline.
Molecular Properties
| Compound Name | N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline |
| PubChem CID | 123711007 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline |
| SMILES | C1=CCC(Nc2ccc(C3OCCCO3)cc2)C=C1 |
| InChI | InChI=1S/C16H19NO2/c1-2-5-14(6-3-1)17-15-9-7-13(8-10-15)16-18-11-4-12-19-16/h1-3,5,7-10,14,16-17H,4,6,11-12H2 |
| InChIKey | YTKSXQPSJVOQFM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline?
The IUPAC name of N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline (CID 123711007) is N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline.
What is the SMILES notation for N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline?
The canonical SMILES for N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline is C1=CCC(Nc2ccc(C3OCCCO3)cc2)C=C1.
What is the InChIKey of N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline?
The InChIKey is YTKSXQPSJVOQFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c1-2-5-14(6-3-1)17-15-9-7-13(8-10-15)16-18-11-4-12-19-16/h1-3,5,7-10,14,16-17H,4,6,11-12H2.
What are the key properties of N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline?
N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline has a molecular weight of 257.33 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-2,4-dien-1-yl-4-(1,3-dioxan-2-yl)aniline is sourced from PubChem (CID 123711007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).