C30H42N6O2 — CID 123711559
3-[4-(1-cyclopentylpiperidin-4-yl)anilino]-4-ethyl-5-(3-formamidopiperidin-1-yl)pyridine-2-carboxamide (PubChem CID 123711559) has the molecular formula C30H42N6O2 and a molecular weight of 518.71 g/mol. Its IUPAC name is 3-[4-(1-cyclopentylpiperidin-4-yl)anilino]-4-ethyl-5-(3-formamidopiperidin-1-yl)pyridine-2-carboxamide.
| Compound Name | 3-[4-(1-cyclopentylpiperidin-4-yl)anilino]-4-ethyl-5-(3-formamidopiperidin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123711559 |
| Molecular Formula | C30H42N6O2 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | 3-[4-(1-cyclopentylpiperidin-4-yl)anilino]-4-ethyl-5-(3-formamidopiperidin-1-yl)pyridine-2-carboxamide |
| SMILES | CCc1c(N2CCCC(NC=O)C2)cnc(C(N)=O)c1Nc1ccc(C2CCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C30H42N6O2/c1-2-26-27(36-15-5-6-24(19-36)33-20-37)18-32-29(30(31)38)28(26)34-23-11-9-21(10-12-23)22-13-16-35(17-14-22)25-7-3-4-8-25/h9-12,18,20,22,24-25,34H,2-8,13-17,19H2,1H3,(H2,31,38)(H,33,37) |
| InChIKey | ADYMSXJUWFEVSF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|