C32H60O7Si2 — CID 123711739
(2R,3R)-4,6-bis[[tert-butyl(methyl)silyl]oxy]-2-cyclopentyl-2-hydroxy-3-(5-methoxy-5-oxopent-2-enyl)undec-4-enoic acid (PubChem CID 123711739) has the molecular formula C32H60O7Si2 and a molecular weight of 613.00 g/mol. Its IUPAC name is (2R,3R)-4,6-bis[[tert-butyl(methyl)silyl]oxy]-2-cyclopentyl-2-hydroxy-3-(5-methoxy-5-oxopent-2-enyl)undec-4-enoic acid.
| Compound Name | (2R,3R)-4,6-bis[[tert-butyl(methyl)silyl]oxy]-2-cyclopentyl-2-hydroxy-3-(5-methoxy-5-oxopent-2-enyl)undec-4-enoic acid |
|---|---|
| PubChem CID | 123711739 |
| Molecular Formula | C32H60O7Si2 |
| Molecular Weight | 613.00 g/mol |
| Exact Mass | 612.39 |
| IUPAC Name | (2R,3R)-4,6-bis[[tert-butyl(methyl)silyl]oxy]-2-cyclopentyl-2-hydroxy-3-(5-methoxy-5-oxopent-2-enyl)undec-4-enoic acid |
| SMILES | CCCCCC(C=C(O[SiH](C)C(C)(C)C)[C@H](CC=CCC(=O)OC)[C@@](O)(C(=O)O)C1CCCC1)O[SiH](C)C(C)(C)C |
| InChI | InChI=1S/C32H60O7Si2/c1-11-12-13-20-25(38-40(9)30(2,3)4)23-27(39-41(10)31(5,6)7)26(21-16-17-22-28(33)37-8)32(36,29(34)35)24-18-14-15-19-24/h16-17,23-26,36,40-41H,11-15,18-22H2,1-10H3,(H,34,35)/t25?,26-,32+,40?,41?/m0/s1 |
| InChIKey | PHKNBBKWWOVALH-ZJHJXHJZSA-N |
| XLogP | 7.29 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.00 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|