C11H18N2O2S — CID 123712125
(3Z)-5-(1,1-dioxo-1,4-thiazinan-4-yl)-N-methylhexa-3,5-dien-2-imine (PubChem CID 123712125) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is (3Z)-5-(1,1-dioxo-1,4-thiazinan-4-yl)-N-methylhexa-3,5-dien-2-imine.
| Compound Name | (3Z)-5-(1,1-dioxo-1,4-thiazinan-4-yl)-N-methylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123712125 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (3Z)-5-(1,1-dioxo-1,4-thiazinan-4-yl)-N-methylhexa-3,5-dien-2-imine |
| SMILES | C=C(/C=C\C(C)=N\C)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H18N2O2S/c1-10(12-3)4-5-11(2)13-6-8-16(14,15)9-7-13/h4-5H,2,6-9H2,1,3H3/b5-4-,12-10+ |
| InChIKey | HMZLULGLWKDCRQ-KYTHIUCFSA-N |
| XLogP | 0.88 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|