C16H26BF3O2 — CID 123712370
(1S,2S,6S)-2,9,9-trimethyl-4-[(2R)-1,1,1-trifluoro-4-methylpentan-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 123712370) has the molecular formula C16H26BF3O2 and a molecular weight of 318.19 g/mol. Its IUPAC name is (1S,2S,6S)-2,9,9-trimethyl-4-[(2R)-1,1,1-trifluoro-4-methylpentan-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6S)-2,9,9-trimethyl-4-[(2R)-1,1,1-trifluoro-4-methylpentan-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 123712370 |
| Molecular Formula | C16H26BF3O2 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (1S,2S,6S)-2,9,9-trimethyl-4-[(2R)-1,1,1-trifluoro-4-methylpentan-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC(C)C[C@@H](B1O[C@H]2CC3C[C@@H](C3(C)C)[C@]2(C)O1)C(F)(F)F |
| InChI | InChI=1S/C16H26BF3O2/c1-9(2)6-12(16(18,19)20)17-21-13-8-10-7-11(14(10,3)4)15(13,5)22-17/h9-13H,6-8H2,1-5H3/t10?,11-,12+,13-,15-/m0/s1 |
| InChIKey | PDDQIANORKBCOO-GWWMPIIRSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|