About amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium
amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium (PubChem CID 123712401) has the molecular formula C12H23N2+
and a molecular weight of 195.33 g/mol. Its IUPAC name is amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium.
Molecular Properties
| Compound Name | amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium |
| PubChem CID | 123712401 |
| Molecular Formula | C12H23N2+ |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.19 |
| IUPAC Name | amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium |
| SMILES | CC[N+](N)(CC)CC1C=CC=CCC1 |
| InChI | InChI=1S/C12H23N2/c1-3-14(13,4-2)11-12-9-7-5-6-8-10-12/h5-7,9,12H,3-4,8,10-11,13H2,1-2H3/q+1 |
| InChIKey | NTZLQFLTXSDQBF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium?
The IUPAC name of amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium (CID 123712401) is amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium.
What is the SMILES notation for amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium?
The canonical SMILES for amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium is CC[N+](N)(CC)CC1C=CC=CCC1.
What is the InChIKey of amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium?
The InChIKey is NTZLQFLTXSDQBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N2/c1-3-14(13,4-2)11-12-9-7-5-6-8-10-12/h5-7,9,12H,3-4,8,10-11,13H2,1-2H3/q+1.
What are the key properties of amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium?
amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium has a molecular weight of 195.33 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for amino-(cyclohepta-2,4-dien-1-ylmethyl)-diethylazanium is sourced from PubChem (CID 123712401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).