C27H39N5O6 — CID 123713003
N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-2-[2-[(2-morpholin-4-ylacetyl)amino]propanoylamino]-3-(prop-2-enylamino)propanamide (PubChem CID 123713003) has the molecular formula C27H39N5O6 and a molecular weight of 529.64 g/mol. Its IUPAC name is N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-2-[2-[(2-morpholin-4-ylacetyl)amino]propanoylamino]-3-(prop-2-enylamino)propanamide.
| Compound Name | N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-2-[2-[(2-morpholin-4-ylacetyl)amino]propanoylamino]-3-(prop-2-enylamino)propanamide |
|---|---|
| PubChem CID | 123713003 |
| Molecular Formula | C27H39N5O6 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-2-[2-[(2-morpholin-4-ylacetyl)amino]propanoylamino]-3-(prop-2-enylamino)propanamide |
| SMILES | C=CCNCC(NC(=O)C(C)NC(=O)CN1CCOCC1)C(=O)NC(Cc1ccccc1)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C27H39N5O6/c1-4-10-28-16-22(31-25(35)19(2)29-23(33)17-32-11-13-37-14-12-32)26(36)30-21(24(34)27(3)18-38-27)15-20-8-6-5-7-9-20/h4-9,19,21-22,28H,1,10-18H2,2-3H3,(H,29,33)(H,30,36)(H,31,35) |
| InChIKey | XJKCVCJAWVSAIJ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|