C30H42N2+2 — CID 123713079
1-(4-hex-5-en-3-yl-2,6-dimethylphenyl)-2,3-dimethyl-4-[2-(3-methylpentan-3-yl)phenyl]-1,3-diazete-1,3-diium (PubChem CID 123713079) has the molecular formula C30H42N2+2 and a molecular weight of 430.68 g/mol. Its IUPAC name is 1-(4-hex-5-en-3-yl-2,6-dimethylphenyl)-2,3-dimethyl-4-[2-(3-methylpentan-3-yl)phenyl]-1,3-diazete-1,3-diium.
| Compound Name | 1-(4-hex-5-en-3-yl-2,6-dimethylphenyl)-2,3-dimethyl-4-[2-(3-methylpentan-3-yl)phenyl]-1,3-diazete-1,3-diium |
|---|---|
| PubChem CID | 123713079 |
| Molecular Formula | C30H42N2+2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | 1-(4-hex-5-en-3-yl-2,6-dimethylphenyl)-2,3-dimethyl-4-[2-(3-methylpentan-3-yl)phenyl]-1,3-diazete-1,3-diium |
| SMILES | C=CCC(CC)c1cc(C)c([N+]2=C(c3ccccc3C(C)(CC)CC)[N+](C)=C2C)c(C)c1 |
| InChI | InChI=1S/C30H42N2/c1-10-16-24(11-2)25-19-21(5)28(22(6)20-25)32-23(7)31(9)29(32)26-17-14-15-18-27(26)30(8,12-3)13-4/h10,14-15,17-20,24H,1,11-13,16H2,2-9H3/q+2 |
| InChIKey | MQRYTCIUXLBKMH-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|