C14H21N — CID 123713088
2,5,6-trimethyl-4-penta-1,3-dien-2-ylcyclohex-3-en-1-imine (PubChem CID 123713088) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2,5,6-trimethyl-4-penta-1,3-dien-2-ylcyclohex-3-en-1-imine.
| Compound Name | 2,5,6-trimethyl-4-penta-1,3-dien-2-ylcyclohex-3-en-1-imine |
|---|---|
| PubChem CID | 123713088 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2,5,6-trimethyl-4-penta-1,3-dien-2-ylcyclohex-3-en-1-imine |
| SMILES | [H]/N=C1\C(C)C=C(C(=C)C=CC)C(C)C1C |
| InChI | InChI=1S/C14H21N/c1-6-7-9(2)13-8-10(3)14(15)12(5)11(13)4/h6-8,10-12,15H,2H2,1,3-5H3/b7-6?,15-14+ |
| InChIKey | SZNYEYBMISYOHE-NPBULVNOSA-N |
| XLogP | 3.99 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|