C25H31NO11 — CID 123713131
(4S)-4-[[(2S,4S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethylidene-5-methoxycarbonyl-4-methylpyran-2-yl]oxyamino]-5-oxopentanoic acid (PubChem CID 123713131) has the molecular formula C25H31NO11 and a molecular weight of 521.52 g/mol. Its IUPAC name is (4S)-4-[[(2S,4S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethylidene-5-methoxycarbonyl-4-methylpyran-2-yl]oxyamino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S,4S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethylidene-5-methoxycarbonyl-4-methylpyran-2-yl]oxyamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123713131 |
| Molecular Formula | C25H31NO11 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | (4S)-4-[[(2S,4S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethylidene-5-methoxycarbonyl-4-methylpyran-2-yl]oxyamino]-5-oxopentanoic acid |
| SMILES | CC=C1[C@H](ON[C@H](C=O)CCC(=O)O)OC=C(C(=O)OC)[C@@]1(C)CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H31NO11/c1-4-17-24(37-26-16(13-27)6-8-21(30)31)36-14-18(23(33)34-3)25(17,2)12-22(32)35-10-9-15-5-7-19(28)20(29)11-15/h4-5,7,11,13-14,16,24,26,28-29H,6,8-10,12H2,1-3H3,(H,30,31)/t16-,24-,25-/m0/s1 |
| InChIKey | OSVCPRBHOAKRAH-BBBIZMJLSA-N |
| XLogP | 1.89 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|