C36H66N2O — CID 123713922
1-[1,9-dimethyl-7-(9-methylheptadeca-10,13-dien-6-yl)-1-azacyclododec-7-en-4-yl]-N-methyl-N-(oxiran-2-ylmethyl)methanamine (PubChem CID 123713922) has the molecular formula C36H66N2O and a molecular weight of 542.94 g/mol. Its IUPAC name is 1-[1,9-dimethyl-7-(9-methylheptadeca-10,13-dien-6-yl)-1-azacyclododec-7-en-4-yl]-N-methyl-N-(oxiran-2-ylmethyl)methanamine.
| Compound Name | 1-[1,9-dimethyl-7-(9-methylheptadeca-10,13-dien-6-yl)-1-azacyclododec-7-en-4-yl]-N-methyl-N-(oxiran-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 123713922 |
| Molecular Formula | C36H66N2O |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.52 |
| IUPAC Name | 1-[1,9-dimethyl-7-(9-methylheptadeca-10,13-dien-6-yl)-1-azacyclododec-7-en-4-yl]-N-methyl-N-(oxiran-2-ylmethyl)methanamine |
| SMILES | CCCC=CCC=CC(C)CCC(CCCCC)C1=CC(C)CCCN(C)CCC(CN(C)CC2CO2)CC1 |
| InChI | InChI=1S/C36H66N2O/c1-7-9-11-12-13-15-17-31(3)20-22-34(19-14-10-8-2)35-23-21-33(28-38(6)29-36-30-39-36)24-26-37(5)25-16-18-32(4)27-35/h11-12,15,17,27,31-34,36H,7-10,13-14,16,18-26,28-30H2,1-6H3 |
| InChIKey | KFISRKLTLWYZFD-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 19.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|