About (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione
(3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione (PubChem CID 123714837) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione.
Molecular Properties
| Compound Name | (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione |
| PubChem CID | 123714837 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione |
| SMILES | C[C@@H]1CC=CCCC(=O)OC[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C14H21NO3/c1-11-6-3-2-4-8-13(16)18-10-12-7-5-9-15(12)14(11)17/h2-3,11-12H,4-10H2,1H3/t11-,12+/m1/s1 |
| InChIKey | MPOBWXSOLRJIMQ-NEPJUHHUSA-N |
| XLogP | 1.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione?
The IUPAC name of (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione (CID 123714837) is (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione.
What is the SMILES notation for (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione?
The canonical SMILES for (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione is C[C@@H]1CC=CCCC(=O)OC[C@@H]2CCCN2C1=O.
What is the InChIKey of (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione?
The InChIKey is MPOBWXSOLRJIMQ-NEPJUHHUSA-N. The full InChI is InChI=1S/C14H21NO3/c1-11-6-3-2-4-8-13(16)18-10-12-7-5-9-15(12)14(11)17/h2-3,11-12H,4-10H2,1H3/t11-,12+/m1/s1.
What are the key properties of (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione?
(3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione has a molecular weight of 251.33 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,12S)-3-methyl-10-oxa-1-azabicyclo[10.3.0]pentadec-5-ene-2,9-dione is sourced from PubChem (CID 123714837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).