C28H33O16+ — CID 123714890
2-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 123714890) has the molecular formula C28H33O16+ and a molecular weight of 625.56 g/mol. Its IUPAC name is 2-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123714890 |
| Molecular Formula | C28H33O16+ |
| Molecular Weight | 625.56 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | 2-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COCC1OC(Oc2cc(O)cc3[o+]c(-c4ccc(O)c(O)c4)c(OC4OC(CO)C(O)C(O)C4O)cc23)C(O)C(O)C1O |
| InChI | InChI=1S/C28H32O16/c1-39-9-19-21(34)23(36)25(38)27(44-19)41-16-6-11(30)5-15-12(16)7-17(26(40-15)10-2-3-13(31)14(32)4-10)42-28-24(37)22(35)20(33)18(8-29)43-28/h2-7,18-25,27-29,33-38H,8-9H2,1H3,(H2-,30,31,32)/p+1 |
| InChIKey | FFYBNBQOTKOTPR-UHFFFAOYSA-O |
| XLogP | -1.49 |
| TPSA | 259.75 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.56 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|