C16H24ClNO — CID 123715047
N-(2-tert-butylpentyl)-4-chlorobenzamide (PubChem CID 123715047) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is N-(2-tert-butylpentyl)-4-chlorobenzamide.
| Compound Name | N-(2-tert-butylpentyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 123715047 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(2-tert-butylpentyl)-4-chlorobenzamide |
| SMILES | CCCC(CNC(=O)c1ccc(Cl)cc1)C(C)(C)C |
| InChI | InChI=1S/C16H24ClNO/c1-5-6-13(16(2,3)4)11-18-15(19)12-7-9-14(17)10-8-12/h7-10,13H,5-6,11H2,1-4H3,(H,18,19) |
| InChIKey | ZLFRIFFJWUCLHF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |