About [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate
[[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate (PubChem CID 123715979) has the molecular formula C12H24N6O7Si3
and a molecular weight of 448.62 g/mol. Its IUPAC name is [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate.
Molecular Properties
| Compound Name | [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate |
| PubChem CID | 123715979 |
| Molecular Formula | C12H24N6O7Si3 |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate |
| SMILES | [H]/N=C\O[SiH](O/C=N/[H])C(CCCOC=C)([SiH](O/C=N/[H])O/C=N/[H])[SiH](O/C=N/[H])O/C=N/[H] |
| InChI | InChI=1S/C12H24N6O7Si3/c1-2-19-5-3-4-12(26(20-6-13)21-7-14,27(22-8-15)23-9-16)28(24-10-17)25-11-18/h2,6-11,13-18,26-28H,1,3-5H2/b13-6-,14-7+,15-8+,16-9+,17-10+,18-11+ |
| InChIKey | XGTNRFHUGBSTCH-LJJIMTOHSA-N |
| XLogP | 0.15 |
| TPSA | 207.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate?
The IUPAC name of [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate (CID 123715979) is [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate.
What is the SMILES notation for [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate?
The canonical SMILES for [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate is [H]/N=C\O[SiH](O/C=N/[H])C(CCCOC=C)([SiH](O/C=N/[H])O/C=N/[H])[SiH](O/C=N/[H])O/C=N/[H].
What is the InChIKey of [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate?
The InChIKey is XGTNRFHUGBSTCH-LJJIMTOHSA-N. The full InChI is InChI=1S/C12H24N6O7Si3/c1-2-19-5-3-4-12(26(20-6-13)21-7-14,27(22-8-15)23-9-16)28(24-10-17)25-11-18/h2,6-11,13-18,26-28H,1,3-5H2/b13-6-,14-7+,15-8+,16-9+,17-10+,18-11+.
What are the key properties of [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate?
[[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate has a molecular weight of 448.62 g/mol, XLogP of 0.15, 20 rotatable bonds, 6 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for [[1,1-bis(dimethanimidoyloxysilyl)-4-ethenoxybutyl]-methanimidoyloxysilyl] methanimidate is sourced from PubChem (CID 123715979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).