C21H26N6O2 — CID 123716763
5-(2-hydroxypropan-2-ylamino)-3-methyl-7-(4-piperazin-1-ylphenyl)pyrido[4,3-d]pyrimidin-4-one (PubChem CID 123716763) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 5-(2-hydroxypropan-2-ylamino)-3-methyl-7-(4-piperazin-1-ylphenyl)pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 5-(2-hydroxypropan-2-ylamino)-3-methyl-7-(4-piperazin-1-ylphenyl)pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 123716763 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 5-(2-hydroxypropan-2-ylamino)-3-methyl-7-(4-piperazin-1-ylphenyl)pyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cn1cnc2cc(-c3ccc(N4CCNCC4)cc3)nc(NC(C)(C)O)c2c1=O |
| InChI | InChI=1S/C21H26N6O2/c1-21(2,29)25-19-18-17(23-13-26(3)20(18)28)12-16(24-19)14-4-6-15(7-5-14)27-10-8-22-9-11-27/h4-7,12-13,22,29H,8-11H2,1-3H3,(H,24,25) |
| InChIKey | SEUPGJZRIPDQHT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|