C29H37F2N3O6Si — CID 123717084
(3R,3aR,6R,6aR)-6-[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 123717084) has the molecular formula C29H37F2N3O6Si and a molecular weight of 589.71 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 123717084 |
| Molecular Formula | C29H37F2N3O6Si |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | C[Si](C)(C)CCOCn1c(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)cc2nc(-c3c(F)cc(N4CCOCC4)cc3F)ccc21 |
| InChI | InChI=1S/C29H37F2N3O6Si/c1-41(2,3)11-10-37-17-34-23-5-4-21(27-19(30)12-18(13-20(27)31)33-6-8-36-9-7-33)32-22(23)14-26(34)40-25-16-39-28-24(35)15-38-29(25)28/h4-5,12-14,24-25,28-29,35H,6-11,15-17H2,1-3H3/t24-,25-,28-,29-/m1/s1 |
| InChIKey | QYDRWSFNSMXJFK-WPUBFDFZSA-N |
| XLogP | 4.04 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|