C23H22FN5O3 — CID 123717534
N-[(1S)-3-[cyano(methyl)amino]-1-(2-methylphenyl)-3-oxopropyl]-1-(2-fluorophenyl)-5-methoxypyrazole-3-carboxamide (PubChem CID 123717534) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[(1S)-3-[cyano(methyl)amino]-1-(2-methylphenyl)-3-oxopropyl]-1-(2-fluorophenyl)-5-methoxypyrazole-3-carboxamide.
| Compound Name | N-[(1S)-3-[cyano(methyl)amino]-1-(2-methylphenyl)-3-oxopropyl]-1-(2-fluorophenyl)-5-methoxypyrazole-3-carboxamide |
|---|---|
| PubChem CID | 123717534 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[(1S)-3-[cyano(methyl)amino]-1-(2-methylphenyl)-3-oxopropyl]-1-(2-fluorophenyl)-5-methoxypyrazole-3-carboxamide |
| SMILES | COc1cc(C(=O)N[C@@H](CC(=O)N(C)C#N)c2ccccc2C)nn1-c1ccccc1F |
| InChI | InChI=1S/C23H22FN5O3/c1-15-8-4-5-9-16(15)18(12-21(30)28(2)14-25)26-23(31)19-13-22(32-3)29(27-19)20-11-7-6-10-17(20)24/h4-11,13,18H,12H2,1-3H3,(H,26,31)/t18-/m0/s1 |
| InChIKey | VMXVWOWGTHSMGB-SFHVURJKSA-N |
| XLogP | 3.13 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|