C12H23NO2S — CID 123717571
N-(3,5,6-trimethylocta-3,5-dienyl)methanesulfonamide (PubChem CID 123717571) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is N-(3,5,6-trimethylocta-3,5-dienyl)methanesulfonamide.
| Compound Name | N-(3,5,6-trimethylocta-3,5-dienyl)methanesulfonamide |
|---|---|
| PubChem CID | 123717571 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-(3,5,6-trimethylocta-3,5-dienyl)methanesulfonamide |
| SMILES | CCC(C)=C(C)C=C(C)CCNS(C)(=O)=O |
| InChI | InChI=1S/C12H23NO2S/c1-6-11(3)12(4)9-10(2)7-8-13-16(5,14)15/h9,13H,6-8H2,1-5H3 |
| InChIKey | HZXZKZXNLBNRPH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|