C24H26N4O3 — CID 123718200
N-[4-[2-[(3R)-oxolane-3-carbonyl]-1,2,3,6-tetrahydropyridin-4-yl]phenyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide (PubChem CID 123718200) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[4-[2-[(3R)-oxolane-3-carbonyl]-1,2,3,6-tetrahydropyridin-4-yl]phenyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[2-[(3R)-oxolane-3-carbonyl]-1,2,3,6-tetrahydropyridin-4-yl]phenyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123718200 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[4-[2-[(3R)-oxolane-3-carbonyl]-1,2,3,6-tetrahydropyridin-4-yl]phenyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide |
| SMILES | O=C(C1CC(c2ccc(NC(=O)N3Cc4ccncc4C3)cc2)=CCN1)[C@@H]1CCOC1 |
| InChI | InChI=1S/C24H26N4O3/c29-23(19-7-10-31-15-19)22-11-17(6-9-26-22)16-1-3-21(4-2-16)27-24(30)28-13-18-5-8-25-12-20(18)14-28/h1-6,8,12,19,22,26H,7,9-11,13-15H2,(H,27,30)/t19-,22?/m1/s1 |
| InChIKey | NCWBIOWQWOSWLQ-LCQOSCCDSA-N |
| XLogP | 2.98 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |