About N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine
N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine (PubChem CID 123718246) has the molecular formula C13H20BrNO
and a molecular weight of 286.21 g/mol. Its IUPAC name is N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine.
Molecular Properties
| Compound Name | N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine |
| PubChem CID | 123718246 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine |
| SMILES | CCN(CCOC)CC1=CCC=CC(Br)=C1 |
| InChI | InChI=1S/C13H20BrNO/c1-3-15(8-9-16-2)11-12-6-4-5-7-13(14)10-12/h5-7,10H,3-4,8-9,11H2,1-2H3 |
| InChIKey | ITVIMMMWGOBLTB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine?
The IUPAC name of N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine (CID 123718246) is N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine.
What is the SMILES notation for N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine?
The canonical SMILES for N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine is CCN(CCOC)CC1=CCC=CC(Br)=C1.
What is the InChIKey of N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine?
The InChIKey is ITVIMMMWGOBLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BrNO/c1-3-15(8-9-16-2)11-12-6-4-5-7-13(14)10-12/h5-7,10H,3-4,8-9,11H2,1-2H3.
What are the key properties of N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine?
N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine has a molecular weight of 286.21 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromocyclohepta-1,4,6-trien-1-yl)methyl]-N-ethyl-2-methoxyethanamine is sourced from PubChem (CID 123718246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).