About 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid
3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid (PubChem CID 123718358) has the molecular formula C17H27NO6
and a molecular weight of 341.40 g/mol. Its IUPAC name is 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid |
| PubChem CID | 123718358 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid |
| SMILES | Cc1c(C2CCCC2)c(O)n(CCOCCOCCC(=O)O)c1O |
| InChI | InChI=1S/C17H27NO6/c1-12-15(13-4-2-3-5-13)17(22)18(16(12)21)7-9-24-11-10-23-8-6-14(19)20/h13,21-22H,2-11H2,1H3,(H,19,20) |
| InChIKey | OCWINCJZAHWHTD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid?
The IUPAC name of 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid (CID 123718358) is 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid.
What is the SMILES notation for 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid?
The canonical SMILES for 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid is Cc1c(C2CCCC2)c(O)n(CCOCCOCCC(=O)O)c1O.
What is the InChIKey of 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid?
The InChIKey is OCWINCJZAHWHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO6/c1-12-15(13-4-2-3-5-13)17(22)18(16(12)21)7-9-24-11-10-23-8-6-14(19)20/h13,21-22H,2-11H2,1H3,(H,19,20).
What are the key properties of 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid?
3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid has a molecular weight of 341.40 g/mol, XLogP of 2.37, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-(3-cyclopentyl-2,5-dihydroxy-4-methylpyrrol-1-yl)ethoxy]ethoxy]propanoic acid is sourced from PubChem (CID 123718358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).