C13H18N6O2 — CID 123718457
2-[3-(4-oxo-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-2-pyridinyl]guanidine (PubChem CID 123718457) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[3-(4-oxo-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-2-pyridinyl]guanidine.
| Compound Name | 2-[3-(4-oxo-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-2-pyridinyl]guanidine |
|---|---|
| PubChem CID | 123718457 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[3-(4-oxo-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-2-pyridinyl]guanidine |
| SMILES | NC(N)=Nc1ncccc1N1CCN2C(=O)COCC2C1 |
| InChI | InChI=1S/C13H18N6O2/c14-13(15)17-12-10(2-1-3-16-12)18-4-5-19-9(6-18)7-21-8-11(19)20/h1-3,9H,4-8H2,(H4,14,15,16,17) |
| InChIKey | YFMYEKSPPMFCIZ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|