About methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate
methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate (PubChem CID 123718506) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate |
| PubChem CID | 123718506 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate |
| SMILES | C/N=C1\C=CC(C(=O)OC)=CC(C)(C)C1 |
| InChI | InChI=1S/C12H17NO2/c1-12(2)7-9(11(14)15-4)5-6-10(8-12)13-3/h5-7H,8H2,1-4H3/b13-10+ |
| InChIKey | OBNKIXCKPILWGJ-JLHYYAGUSA-N |
| XLogP | 2.14 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate?
The IUPAC name of methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate (CID 123718506) is methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate.
What is the SMILES notation for methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate?
The canonical SMILES for methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate is C/N=C1\C=CC(C(=O)OC)=CC(C)(C)C1.
What is the InChIKey of methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate?
The InChIKey is OBNKIXCKPILWGJ-JLHYYAGUSA-N. The full InChI is InChI=1S/C12H17NO2/c1-12(2)7-9(11(14)15-4)5-6-10(8-12)13-3/h5-7H,8H2,1-4H3/b13-10+.
What are the key properties of methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate?
methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate has a molecular weight of 207.27 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,3-dimethyl-5-methyliminocyclohepta-1,6-diene-1-carboxylate is sourced from PubChem (CID 123718506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).