C17H20N4 — CID 123718763
4-octa-2,4-dien-3-yl-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 123718763) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 4-octa-2,4-dien-3-yl-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-octa-2,4-dien-3-yl-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123718763 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-octa-2,4-dien-3-yl-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | CC=C(C=CCCC)c1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H20N4/c1-3-5-7-10-13(4-2)15-19-16(21-17(18)20-15)14-11-8-6-9-12-14/h4,6-12H,3,5H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | CEJLQZGQYCMJGL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|