C16H21N — CID 123719547
9,9,10-trimethyl-1,2,8,8a-tetrahydroacridine (PubChem CID 123719547) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 9,9,10-trimethyl-1,2,8,8a-tetrahydroacridine.
| Compound Name | 9,9,10-trimethyl-1,2,8,8a-tetrahydroacridine |
|---|---|
| PubChem CID | 123719547 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 9,9,10-trimethyl-1,2,8,8a-tetrahydroacridine |
| SMILES | CN1C2=CC=CCC2C(C)(C)C2=C1C=CCC2 |
| InChI | InChI=1S/C16H21N/c1-16(2)12-8-4-6-10-14(12)17(3)15-11-7-5-9-13(15)16/h4,6-7,10-12H,5,8-9H2,1-3H3 |
| InChIKey | LTYXOORJHHLAER-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |