C25H23NO3 — CID 123719821
4-(4-methoxydibenzofuran-1-yl)-1-[(4-methylphenyl)methyl]pyrrolidin-2-one (PubChem CID 123719821) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-(4-methoxydibenzofuran-1-yl)-1-[(4-methylphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-(4-methoxydibenzofuran-1-yl)-1-[(4-methylphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123719821 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-(4-methoxydibenzofuran-1-yl)-1-[(4-methylphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C2CC(=O)N(Cc3ccc(C)cc3)C2)c2c1oc1ccccc12 |
| InChI | InChI=1S/C25H23NO3/c1-16-7-9-17(10-8-16)14-26-15-18(13-23(26)27)19-11-12-22(28-2)25-24(19)20-5-3-4-6-21(20)29-25/h3-12,18H,13-15H2,1-2H3 |
| InChIKey | XTAZNXFIQQNBNG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |