C31H27F6N5O2 — CID 123720146
5-[2-[2-(3,5-difluorophenyl)-1-[[2-[4-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 123720146) has the molecular formula C31H27F6N5O2 and a molecular weight of 615.58 g/mol. Its IUPAC name is 5-[2-[2-(3,5-difluorophenyl)-1-[[2-[4-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[2-(3,5-difluorophenyl)-1-[[2-[4-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 123720146 |
| Molecular Formula | C31H27F6N5O2 |
| Molecular Weight | 615.58 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | 5-[2-[2-(3,5-difluorophenyl)-1-[[2-[4-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | CC1CCCc2c1c(C(F)(F)F)nn2CC(=O)NC(Cc1cc(F)cc(F)c1)c1ncccc1-c1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C31H27F6N5O2/c1-16-4-2-6-25-27(16)29(31(35,36)37)41-42(25)15-26(43)40-24(12-17-10-19(32)14-20(33)11-17)28-21(5-3-9-39-28)18-7-8-23(34)22(13-18)30(38)44/h3,5,7-11,13-14,16,24H,2,4,6,12,15H2,1H3,(H2,38,44)(H,40,43) |
| InChIKey | NTHHYCNSPALBQK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |