About 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine
3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine (PubChem CID 123720355) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine.
Molecular Properties
| Compound Name | 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine |
| PubChem CID | 123720355 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine |
| SMILES | CCCCC(C)C(C(C)NC)N(C)N |
| InChI | InChI=1S/C11H27N3/c1-6-7-8-9(2)11(14(5)12)10(3)13-4/h9-11,13H,6-8,12H2,1-5H3 |
| InChIKey | PPJHFGMZBXTDHY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine?
The IUPAC name of 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine (CID 123720355) is 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine.
What is the SMILES notation for 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine?
The canonical SMILES for 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine is CCCCC(C)C(C(C)NC)N(C)N.
What is the InChIKey of 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine?
The InChIKey is PPJHFGMZBXTDHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N3/c1-6-7-8-9(2)11(14(5)12)10(3)13-4/h9-11,13H,6-8,12H2,1-5H3.
What are the key properties of 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine?
3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine has a molecular weight of 201.36 g/mol, XLogP of 1.59, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino(methyl)amino]-N,4-dimethyloctan-2-amine is sourced from PubChem (CID 123720355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).