C24H32N2O6 — CID 123720508
[2-[(2S,3S,7aS,12bS)-3-ethyl-7a-hydroxy-9-(hydroxymethyl)-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enyl] formate (PubChem CID 123720508) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-[(2S,3S,7aS,12bS)-3-ethyl-7a-hydroxy-9-(hydroxymethyl)-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enyl] formate.
| Compound Name | [2-[(2S,3S,7aS,12bS)-3-ethyl-7a-hydroxy-9-(hydroxymethyl)-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enyl] formate |
|---|---|
| PubChem CID | 123720508 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [2-[(2S,3S,7aS,12bS)-3-ethyl-7a-hydroxy-9-(hydroxymethyl)-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enyl] formate |
| SMILES | CC[C@@H]1CN2CC[C@@]3(O)C(=Nc4ccc(CO)c(OC)c43)[C@@H]2C[C@@H]1C(=COC)COC=O |
| InChI | InChI=1S/C24H32N2O6/c1-4-15-10-26-8-7-24(29)21-19(6-5-16(11-27)22(21)31-3)25-23(24)20(26)9-18(15)17(12-30-2)13-32-14-28/h5-6,12,14-15,18,20,27,29H,4,7-11,13H2,1-3H3/t15-,18+,20+,24+/m1/s1 |
| InChIKey | LNNIODNTFLQXBF-LYBYTVLUSA-N |
| XLogP | 2.28 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|