About 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one
2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one (PubChem CID 123720781) has the molecular formula C16H18FNO4
and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one |
| PubChem CID | 123720781 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one |
| SMILES | O=C1OC2(CCCCC2)OC12CC(c1ccccc1F)NO2 |
| InChI | InChI=1S/C16H18FNO4/c17-12-7-3-2-6-11(12)13-10-16(22-18-13)14(19)20-15(21-16)8-4-1-5-9-15/h2-3,6-7,13,18H,1,4-5,8-10H2 |
| InChIKey | NLFCPTJTPFYCDN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one?
The IUPAC name of 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one (CID 123720781) is 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one.
What is the SMILES notation for 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one?
The canonical SMILES for 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one is O=C1OC2(CCCCC2)OC12CC(c1ccccc1F)NO2.
What is the InChIKey of 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one?
The InChIKey is NLFCPTJTPFYCDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNO4/c17-12-7-3-2-6-11(12)13-10-16(22-18-13)14(19)20-15(21-16)8-4-1-5-9-15/h2-3,6-7,13,18H,1,4-5,8-10H2.
What are the key properties of 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one?
2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one has a molecular weight of 307.32 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-4,6,13-trioxa-3-azadispiro[4.1.57.25]tetradecan-14-one is sourced from PubChem (CID 123720781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).