About 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol
2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 123721732) has the molecular formula C20H18Cl2O4
and a molecular weight of 393.27 g/mol. Its IUPAC name is 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol.
Molecular Properties
| Compound Name | 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol |
| PubChem CID | 123721732 |
| Molecular Formula | C20H18Cl2O4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OCC1CC(O)C(O)C(c2cccc(C#Cc3cc(Cl)cc(Cl)c3)c2)O1 |
| InChI | InChI=1S/C20H18Cl2O4/c21-15-7-13(8-16(22)9-15)5-4-12-2-1-3-14(6-12)20-19(25)18(24)10-17(11-23)26-20/h1-3,6-9,17-20,23-25H,10-11H2 |
| InChIKey | XPTHXMMWSQCISU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol?
The IUPAC name of 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol (CID 123721732) is 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol.
What is the SMILES notation for 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol?
The canonical SMILES for 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol is OCC1CC(O)C(O)C(c2cccc(C#Cc3cc(Cl)cc(Cl)c3)c2)O1.
What is the InChIKey of 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol?
The InChIKey is XPTHXMMWSQCISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2O4/c21-15-7-13(8-16(22)9-15)5-4-12-2-1-3-14(6-12)20-19(25)18(24)10-17(11-23)26-20/h1-3,6-9,17-20,23-25H,10-11H2.
What are the key properties of 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol?
2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol has a molecular weight of 393.27 g/mol, XLogP of 2.94, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(3,5-dichlorophenyl)ethynyl]phenyl]-6-(hydroxymethyl)oxane-3,4-diol is sourced from PubChem (CID 123721732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).