C24H37BN2O5S — CID 123721760
[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-methyl-N-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]carbamate (PubChem CID 123721760) has the molecular formula C24H37BN2O5S and a molecular weight of 476.45 g/mol. Its IUPAC name is [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-methyl-N-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]carbamate.
| Compound Name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-methyl-N-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 123721760 |
| Molecular Formula | C24H37BN2O5S |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-methyl-N-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]carbamate |
| SMILES | CN(C(=O)OCc1cccc(B2OC(C)(C)C(C)(C)O2)c1)C1CCC(CNC(=O)CCS)C1 |
| InChI | InChI=1S/C24H37BN2O5S/c1-23(2)24(3,4)32-25(31-23)19-8-6-7-18(13-19)16-30-22(29)27(5)20-10-9-17(14-20)15-26-21(28)11-12-33/h6-8,13,17,20,33H,9-12,14-16H2,1-5H3,(H,26,28) |
| InChIKey | QHMSJDKAAYSOGU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|