C10H16N2O9 — CID 123722329
2-[[2-(1-aminoethoxy)-2-oxoethyl]-(carboxymethyl)amino]-3-hydroxybutanedioic acid (PubChem CID 123722329) has the molecular formula C10H16N2O9 and a molecular weight of 308.24 g/mol. Its IUPAC name is 2-[[2-(1-aminoethoxy)-2-oxoethyl]-(carboxymethyl)amino]-3-hydroxybutanedioic acid.
| Compound Name | 2-[[2-(1-aminoethoxy)-2-oxoethyl]-(carboxymethyl)amino]-3-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 123722329 |
| Molecular Formula | C10H16N2O9 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[[2-(1-aminoethoxy)-2-oxoethyl]-(carboxymethyl)amino]-3-hydroxybutanedioic acid |
| SMILES | CC(N)OC(=O)CN(CC(=O)O)C(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C10H16N2O9/c1-4(11)21-6(15)3-12(2-5(13)14)7(9(17)18)8(16)10(19)20/h4,7-8,16H,2-3,11H2,1H3,(H,13,14)(H,17,18)(H,19,20) |
| InChIKey | IOQMDKHELNNGFU-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|