About 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene
1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene (PubChem CID 123722385) has the molecular formula C8H8F2O
and a molecular weight of 158.15 g/mol. Its IUPAC name is 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene |
| PubChem CID | 123722385 |
| Molecular Formula | C8H8F2O |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene |
| SMILES | C=C1C=CC(OC)=C(F)C1F |
| InChI | InChI=1S/C8H8F2O/c1-5-3-4-6(11-2)8(10)7(5)9/h3-4,7H,1H2,2H3 |
| InChIKey | NCMJUKUMTSOTIP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene?
The IUPAC name of 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene (CID 123722385) is 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene.
What is the SMILES notation for 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene?
The canonical SMILES for 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene is C=C1C=CC(OC)=C(F)C1F.
What is the InChIKey of 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene?
The InChIKey is NCMJUKUMTSOTIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2O/c1-5-3-4-6(11-2)8(10)7(5)9/h3-4,7H,1H2,2H3.
What are the key properties of 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene?
1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene has a molecular weight of 158.15 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-difluoro-2-methoxy-5-methylidenecyclohexa-1,3-diene is sourced from PubChem (CID 123722385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).