C26H25N5O2 — CID 123722516
2-[4-(4-hydroxyphenyl)piperazin-1-yl]-N-(3-quinoxalin-2-ylphenyl)acetamide (PubChem CID 123722516) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[4-(4-hydroxyphenyl)piperazin-1-yl]-N-(3-quinoxalin-2-ylphenyl)acetamide.
| Compound Name | 2-[4-(4-hydroxyphenyl)piperazin-1-yl]-N-(3-quinoxalin-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 123722516 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[4-(4-hydroxyphenyl)piperazin-1-yl]-N-(3-quinoxalin-2-ylphenyl)acetamide |
| SMILES | O=C(CN1CCN(c2ccc(O)cc2)CC1)Nc1cccc(-c2cnc3ccccc3n2)c1 |
| InChI | InChI=1S/C26H25N5O2/c32-22-10-8-21(9-11-22)31-14-12-30(13-15-31)18-26(33)28-20-5-3-4-19(16-20)25-17-27-23-6-1-2-7-24(23)29-25/h1-11,16-17,32H,12-15,18H2,(H,28,33) |
| InChIKey | CHWAGAATRCVYKE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |