C22H36 — CID 123722640
1,6-dimethyl-7-[(4-methylcyclohexyl)methyl]-5,8-dimethylidene-1,2,3,4,4a,6,7,8a-octahydronaphthalene (PubChem CID 123722640) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is 1,6-dimethyl-7-[(4-methylcyclohexyl)methyl]-5,8-dimethylidene-1,2,3,4,4a,6,7,8a-octahydronaphthalene.
| Compound Name | 1,6-dimethyl-7-[(4-methylcyclohexyl)methyl]-5,8-dimethylidene-1,2,3,4,4a,6,7,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 123722640 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 1,6-dimethyl-7-[(4-methylcyclohexyl)methyl]-5,8-dimethylidene-1,2,3,4,4a,6,7,8a-octahydronaphthalene |
| SMILES | C=C1C(C)C(CC2CCC(C)CC2)C(=C)C2C(C)CCCC12 |
| InChI | InChI=1S/C22H36/c1-14-9-11-19(12-10-14)13-21-17(4)16(3)20-8-6-7-15(2)22(20)18(21)5/h14-15,17,19-22H,3,5-13H2,1-2,4H3 |
| InChIKey | PPRAUAASNRIJFF-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|