C8H11F4N — CID 123723449
5,7,7,7-tetrafluoro-6-methylhepta-3,5-dien-2-amine (PubChem CID 123723449) has the molecular formula C8H11F4N and a molecular weight of 197.17 g/mol. Its IUPAC name is 5,7,7,7-tetrafluoro-6-methylhepta-3,5-dien-2-amine.
| Compound Name | 5,7,7,7-tetrafluoro-6-methylhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 123723449 |
| Molecular Formula | C8H11F4N |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 5,7,7,7-tetrafluoro-6-methylhepta-3,5-dien-2-amine |
| SMILES | CC(=C(F)C=CC(C)N)C(F)(F)F |
| InChI | InChI=1S/C8H11F4N/c1-5(13)3-4-7(9)6(2)8(10,11)12/h3-5H,13H2,1-2H3 |
| InChIKey | POZIWTRXJIDJIL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|