C30H30N3O4S- — CID 123723465
3-carbamoyl-5-(cyclopropylmethyl)-2-(4-methylphenyl)-6-[3-phenylpent-4-enyl(sulfinato)amino]furo[2,3-b]pyridine (PubChem CID 123723465) has the molecular formula C30H30N3O4S- and a molecular weight of 528.65 g/mol. Its IUPAC name is 3-carbamoyl-5-(cyclopropylmethyl)-2-(4-methylphenyl)-6-[3-phenylpent-4-enyl(sulfinato)amino]furo[2,3-b]pyridine.
| Compound Name | 3-carbamoyl-5-(cyclopropylmethyl)-2-(4-methylphenyl)-6-[3-phenylpent-4-enyl(sulfinato)amino]furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123723465 |
| Molecular Formula | C30H30N3O4S- |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 3-carbamoyl-5-(cyclopropylmethyl)-2-(4-methylphenyl)-6-[3-phenylpent-4-enyl(sulfinato)amino]furo[2,3-b]pyridine |
| SMILES | C=CC(CCN(c1nc2oc(-c3ccc(C)cc3)c(C(N)=O)c2cc1CC1CC1)S(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C30H31N3O4S/c1-3-21(22-7-5-4-6-8-22)15-16-33(38(35)36)29-24(17-20-11-12-20)18-25-26(28(31)34)27(37-30(25)32-29)23-13-9-19(2)10-14-23/h3-10,13-14,18,20-21H,1,11-12,15-17H2,2H3,(H2,31,34)(H,35,36)/p-1 |
| InChIKey | DNAUXXSBKZANFM-UHFFFAOYSA-M |
| XLogP | 5.82 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|