C15H27F2N3 — CID 123723512
2-[(4,4-difluorocyclohexyl)methyl]-N,N-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine (PubChem CID 123723512) has the molecular formula C15H27F2N3 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexyl)methyl]-N,N-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine.
| Compound Name | 2-[(4,4-difluorocyclohexyl)methyl]-N,N-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine |
|---|---|
| PubChem CID | 123723512 |
| Molecular Formula | C15H27F2N3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-[(4,4-difluorocyclohexyl)methyl]-N,N-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine |
| SMILES | CN(C)N1CC2CN(CC3CCC(F)(F)CC3)CC2C1 |
| InChI | InChI=1S/C15H27F2N3/c1-18(2)20-10-13-8-19(9-14(13)11-20)7-12-3-5-15(16,17)6-4-12/h12-14H,3-11H2,1-2H3 |
| InChIKey | GDKLMSZTHXZALN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |