C27H47N — CID 123723596
N-methyl-N-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)cyclohexanamine (PubChem CID 123723596) has the molecular formula C27H47N and a molecular weight of 385.68 g/mol. Its IUPAC name is N-methyl-N-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)cyclohexanamine.
| Compound Name | N-methyl-N-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)cyclohexanamine |
|---|---|
| PubChem CID | 123723596 |
| Molecular Formula | C27H47N |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | N-methyl-N-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)cyclohexanamine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCN(C)C1CCCCC1 |
| InChI | InChI=1S/C27H47N/c1-23(2)13-10-14-24(3)15-11-16-25(4)17-12-18-26(5)21-22-28(6)27-19-8-7-9-20-27/h13,15,17,21,27H,7-12,14,16,18-20,22H2,1-6H3 |
| InChIKey | WUBAGWUVXPCHFF-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|