About [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate
[(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate (PubChem CID 123723735) has the molecular formula C16H30O3Si
and a molecular weight of 298.50 g/mol. Its IUPAC name is [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate.
Molecular Properties
| Compound Name | [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
| PubChem CID | 123723735 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
| SMILES | C=CC[C@@H](C)OC(=O)C[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-9-11-13(3)18-15(17)12-14(10-2)19-20(7,8)16(4,5)6/h9-10,13-14H,1-2,11-12H2,3-8H3/t13-,14+/m1/s1 |
| InChIKey | TYAWYVNLVGAYDW-KGLIPLIRSA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate?
The IUPAC name of [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate (CID 123723735) is [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate.
What is the SMILES notation for [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate?
The canonical SMILES for [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate is C=CC[C@@H](C)OC(=O)C[C@H](C=C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate?
The InChIKey is TYAWYVNLVGAYDW-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H30O3Si/c1-9-11-13(3)18-15(17)12-14(10-2)19-20(7,8)16(4,5)6/h9-10,13-14H,1-2,11-12H2,3-8H3/t13-,14+/m1/s1.
What are the key properties of [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate?
[(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate has a molecular weight of 298.50 g/mol, XLogP of 4.46, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-pent-4-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate is sourced from PubChem (CID 123723735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).